EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22N2O6 |
| Net Charge | 0 |
| Average Mass | 470.481 |
| Monoisotopic Mass | 470.14779 |
| SMILES | Cc1c(OCC(=O)N[C@@H](Cc2cnc3ccccc23)C(=O)O)ccc2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C27H22N2O6/c1-15-23(11-10-19-18-7-2-3-8-20(18)27(33)35-25(15)19)34-14-24(30)29-22(26(31)32)12-16-13-28-21-9-5-4-6-17(16)21/h2-11,13,22,28H,12,14H2,1H3,(H,29,30)(H,31,32)/t22-/m0/s1 |
| InChIKey | KPSVCBXPHRRKCB-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-3-(1H-indol-3-yl)-2-[[2-[(4-methyl-6-oxo-3-benzo[c][1]benzopyranyl)oxy]-1-oxoethyl]amino]propanoic acid (CHEBI:105006) is a N-acyl-L-amino acid (CHEBI:21644) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16369 | LINCS |