EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15FN4O2 |
| Net Charge | 0 |
| Average Mass | 314.320 |
| Monoisotopic Mass | 314.11790 |
| SMILES | CC(CC(=O)Nc1ccc(F)cc1)=NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C16H15FN4O2/c1-11(20-21-16(23)14-4-2-3-9-18-14)10-15(22)19-13-7-5-12(17)6-8-13/h2-9H,10H2,1H3,(H,19,22)(H,21,23) |
| InChIKey | YZHSDKOZLVOGDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-2-pyridinecarboxamide (CHEBI:104992) is a aromatic carboxylic acid (CHEBI:33859) |
| N-[[4-(4-fluoroanilino)-4-oxobutan-2-ylidene]amino]-2-pyridinecarboxamide (CHEBI:104992) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16355 | LINCS |