EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19F2N3O7 |
| Net Charge | 0 |
| Average Mass | 439.371 |
| Monoisotopic Mass | 439.11911 |
| SMILES | COc1cc(C=CC(=O)OCC(=O)c2c(N)n(C)c(=O)n(C)c2=O)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F2N3O7/c1-23-16(22)15(17(27)24(2)19(23)28)11(25)9-30-14(26)7-5-10-4-6-12(31-18(20)21)13(8-10)29-3/h4-8,18H,9,22H2,1-3H3 |
| InChIKey | YYOCXODFEFIMFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-propenoic acid [2-(4-amino-1,3-dimethyl-2,6-dioxo-5-pyrimidinyl)-2-oxoethyl] ester (CHEBI:104924) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16287 | LINCS |