EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3S |
| Net Charge | 0 |
| Average Mass | 223.253 |
| Monoisotopic Mass | 223.03031 |
| SMILES | O=C(O)C1CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C10H9NO3S/c12-8-4-2-1-3-6(8)9-11-7(5-15-9)10(13)14/h1-4,7,12H,5H2,(H,13,14) |
| InChIKey | CECDPVOEINSAQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-hydroxyphenyl)-4,5-dihydrothiazole-4-carboxylic acid (CHEBI:104585) is a imidothioate (CHEBI:83991) |
| 2-(2-hydroxyphenyl)-4,5-dihydrothiazole-4-carboxylic acid (CHEBI:104585) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| 2'-hydroxyphenyl-2-thiazoline-4-oyl group (CHEBI:60433) is substituent group from 2-(2-hydroxyphenyl)-4,5-dihydrothiazole-4-carboxylic acid (CHEBI:104585) |
| IUPAC Name |
|---|
| 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Dihydroaeruginoic acid | ChemIDplus |
| 2'-(2-Hydroxyphenyl)-2'-thiazoline-4'-carboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:748521 | Beilstein |
| Beilstein:1988927 | Beilstein |
| CAS:49608-51-7 | ChemIDplus |