EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO5 |
| Net Charge | 0 |
| Average Mass | 192.554 |
| Monoisotopic Mass | 191.98255 |
| SMILES | O=C(O)CC(=O)/C=C(/Cl)C(=O)O |
| InChI | InChI=1S/C6H5ClO5/c7-4(6(11)12)1-3(8)2-5(9)10/h1H,2H2,(H,9,10)(H,11,12)/b4-1+ |
| InChIKey | QOHGUQUQCPIROQ-DAFODLJHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloromaleylacetic acid (CHEBI:28489) has functional parent maleylacetic acid (CHEBI:1184) |
| 2-chloromaleylacetic acid (CHEBI:28489) has role bacterial metabolite (CHEBI:76969) |
| 2-chloromaleylacetic acid (CHEBI:28489) is a organochlorine compound (CHEBI:36683) |
| 2-chloromaleylacetic acid (CHEBI:28489) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-chloromaleylacetic acid (CHEBI:28489) is conjugate acid of 2-chloromaleylacetate (CHEBI:231622) |
| Incoming Relation(s) |
| 2-chloromaleylacetate (CHEBI:231622) is conjugate base of 2-chloromaleylacetic acid (CHEBI:28489) |
| IUPAC Name |
|---|
| (2E)-2-chloro-4-oxohex-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 2-chloro(maleyl)acetic acid | ChEBI |
| (E)-2-chloro-4-oxo-2-hexenedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00007488 | KNApSAcK |
| Citations |
|---|