EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | CC(C)c1cccc(=O)c(O)c1 |
| InChI | InChI=1S/C10H12O2/c1-7(2)8-4-3-5-9(11)10(12)6-8/h3-7H,1-2H3,(H,11,12) |
| InChIKey | FUWUEFKEXZQKKA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chamaecyparis obtusa (ncbitaxon:13415) | - | PubMed (15917561) | |
| Thuja plicata (ncbitaxon:3316) | - | PubMed (18118412) | |
| Thujopsis dolabrata (ncbitaxon:13727) | - | PubMed (17927050) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-thujaplicin (CHEBI:10447) has parent hydride cyclohepta-1,3,5-triene (CHEBI:37519) |
| β-thujaplicin (CHEBI:10447) has role antibacterial agent (CHEBI:33282) |
| β-thujaplicin (CHEBI:10447) has role antifungal agent (CHEBI:35718) |
| β-thujaplicin (CHEBI:10447) has role antineoplastic agent (CHEBI:35610) |
| β-thujaplicin (CHEBI:10447) has role antiplasmodial drug (CHEBI:64915) |
| β-thujaplicin (CHEBI:10447) has role plant metabolite (CHEBI:76924) |
| β-thujaplicin (CHEBI:10447) is a cyclic ketone (CHEBI:3992) |
| β-thujaplicin (CHEBI:10447) is a enol (CHEBI:33823) |
| β-thujaplicin (CHEBI:10447) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| 2-hydroxy-4-(propan-2-yl)cyclohepta-2,4,6-trien-1-one |
| Synonyms | Source |
|---|---|
| 2-hydroxy-4-isopropyl-cyclohepta2,4,6-trien-1-one | ChEBI |
| 4-Isopropyltropolone | KEGG COMPOUND |
| beta-Thujaplicin | KEGG COMPOUND |
| Hinokitiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003062 | KNApSAcK |
| C09904 | KEGG COMPOUND |
| D04876 | KEGG DRUG |
| Hinokitiol | Wikipedia |
| HMDB0035213 | HMDB |
| LSM-2835 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2045206 | Reaxys |
| CAS:499-44-5 | ChemIDplus |
| CAS:499-44-5 | KEGG COMPOUND |
| Citations |
|---|