EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C1[C@@H]2CC[C@@H](C2)[C@@]1(C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-11(2)6-5-9-15(4)12(3)13-7-8-14(15)10-13/h6,13-14H,3,5,7-10H2,1-2,4H3/t13-,14+,15+/m1/s1 |
| InChIKey | PGBNIHXXFQBCPU-ILXRZTDVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-β-santalene (CHEBI:10440) has role plant metabolite (CHEBI:76924) |
| (−)-β-santalene (CHEBI:10440) is a bridged compound (CHEBI:35990) |
| (−)-β-santalene (CHEBI:10440) is a carbobicyclic compound (CHEBI:36785) |
| (−)-β-santalene (CHEBI:10440) is a polycyclic olefin (CHEBI:35714) |
| (−)-β-santalene (CHEBI:10440) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,2R,4R)-2-methyl-3-methylidene-2-(4-methylpent-3-en-1-yl)bicyclo[2.2.1]heptane |
| Synonyms | Source |
|---|---|
| (1S-exo)-2-methyl-3-methylene-2-(4-methyl-3-pentenyl)bicyclo[2.2.1]heptane | ChEBI |
| beta-Santalene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (−)-β-santalene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003181 | KNApSAcK |
| C09718 | KEGG COMPOUND |
| CPD-11378 | MetaCyc |
| WO2010067309 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3126764 | Reaxys |
| CAS:511-59-1 | KEGG COMPOUND |
| CAS:511-59-1 | ChemIDplus |
| Citations |
|---|