EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | CC1(C)CCC2=C(O1)c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C15H14O3/c1-15(2)8-7-11-13(17)12(16)9-5-3-4-6-10(9)14(11)18-15/h3-6H,7-8H2,1-2H3 |
| InChIKey | QZPQTZZNNJUOLS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tabebuia avellanedae (IPNI:110853-1) | bark (BTO:0001301) | PubMed (16822200) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-lapachone (CHEBI:10429) has role anti-inflammatory agent (CHEBI:67079) |
| β-lapachone (CHEBI:10429) has role antineoplastic agent (CHEBI:35610) |
| β-lapachone (CHEBI:10429) has role plant metabolite (CHEBI:76924) |
| β-lapachone (CHEBI:10429) is a benzochromenone (CHEBI:64986) |
| β-lapachone (CHEBI:10429) is a orthoquinones (CHEBI:25622) |
| IUPAC Name |
|---|
| 2,2-dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-2,2-dimethyl-2H-naphtho(1,2-b)pyran-5,6-dione | ChEBI |
| ARQ 501 | ChemIDplus |
| beta-Lapachone | KEGG COMPOUND |
| β-lap | ChEBI |
| Citations |
|---|