EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12C[C@H](C(C)(C)O)CC[C@@]1(C)CCCC2=C |
| InChI | InChI=1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h12-13,16H,1,5-10H2,2-4H3/t12-,13+,15-/m1/s1 |
| InChIKey | BOPIMTNSYWYZOC-VNHYZAJKSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-eudesmol (CHEBI:10417) has role volatile oil component (CHEBI:27311) |
| β-eudesmol (CHEBI:10417) is a carbobicyclic compound (CHEBI:36785) |
| β-eudesmol (CHEBI:10417) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| β-eudesmol (CHEBI:10417) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Names |
|---|
| 2-[(2R,4aR,8aS)-4a-methyl-8-methylidenedecahydronaphthalen-2-yl]propan-2-ol |
| eudesm-4(14)-en-11-ol |
| Synonyms | Source |
|---|---|
| (2R,4aR,8aS)-decahydro-8-methylene-α,α,4a-trimethyl-2-naphthylmethanol | ChEBI |
| beta-Eudesmol | KEGG COMPOUND |
| β-selinenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| β-eudesmol | UniProt |
| Citations |
|---|