EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O2 |
| Net Charge | 0 |
| Average Mass | 98.101 |
| Monoisotopic Mass | 98.03678 |
| SMILES | C=C1CCOC1=O |
| InChI | InChI=1S/C5H6O2/c1-4-2-3-7-5(4)6/h1-3H2 |
| InChIKey | GSLDEZOOOSBFGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methylene γ-butyrolactone (CHEBI:104120) has role anti-ulcer drug (CHEBI:49201) |
| α-methylene γ-butyrolactone (CHEBI:104120) has role gastrointestinal drug (CHEBI:55324) |
| α-methylene γ-butyrolactone (CHEBI:104120) is a butan-4-olide (CHEBI:22950) |
| Incoming Relation(s) |
| anthecotulide (CHEBI:141397) has functional parent α-methylene γ-butyrolactone (CHEBI:104120) |
| IUPAC Name |
|---|
| 3-methylideneoxolan-2-one |
| Synonyms | Source |
|---|---|
| 3-Methylenedihydro-2(3H)-furanone | NIST Chemistry WebBook |
| alpha-Methylene butyrolactone | ChemIDplus |
| alpha-methylene gamma-butyrolactone | ChEBI |
| Dihydro-3-methylene-2(3H)-furanone | ChemIDplus |
| Tulipalin A | NIST Chemistry WebBook |
| α-methylene-γ-butyrolactone | ChEBI |
| UniProt Name | Source |
|---|---|
| tulipalin A | UniProt |
| Citations |
|---|