EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 407.341 |
| Monoisotopic Mass | 406.12148 |
| SMILES | CCCNCC1C(Oc2ccc(Cl)cc2Cl)C(=O)N1c1cccc(C)c1C |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-4-10-24-12-18-20(27-19-9-8-15(22)11-16(19)23)21(26)25(18)17-7-5-6-13(2)14(17)3/h5-9,11,18,20,24H,4,10,12H2,1-3H3 |
| InChIKey | PABJFNUPGAPYHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2,4-dichlorophenoxy)-1-(2,3-dimethylphenyl)-4-(propylaminomethyl)-2-azetidinone (CHEBI:104072) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| LSM-15430 | LINCS |