EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | COc1ccc(C(=O)OC2C[C@H]3CC[C@H](C2)N3C)cc1OC |
| InChI | InChI=1S/C17H23NO4/c1-18-12-5-6-13(18)10-14(9-12)22-17(19)11-4-7-15(20-2)16(8-11)21-3/h4,7-8,12-14H,5-6,9-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | AEFPCFUCFQBXDQ-CHWSQXEVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxybenzoic acid [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester (CHEBI:104025) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-15383 | LINCS |