EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N4O |
| Net Charge | 0 |
| Average Mass | 286.379 |
| Monoisotopic Mass | 286.17936 |
| SMILES | COc1ccc(CN(CCN(C)C)c2ncccn2)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-19(2)11-12-20(16-17-9-4-10-18-16)13-14-5-7-15(21-3)8-6-14/h4-10H,11-13H2,1-3H3 |
| InChIKey | GULNIHOSWFYMRN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-[(4-methoxyphenyl)methyl]-N,N-dimethyl-N'-(2-pyrimidinyl)ethane-1,2-diamine (CHEBI:104017) has role nasal decongestant (CHEBI:77715) |
| N'-[(4-methoxyphenyl)methyl]-N,N-dimethyl-N'-(2-pyrimidinyl)ethane-1,2-diamine (CHEBI:104017) is a methoxybenzenes (CHEBI:51683) |
| INN | Source |
|---|---|
| tonzilamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| neohetramine | DrugCentral |
| thonzylamine | ChEMBL |
| Thonzylamine | ChEMBL |
| Tonamil | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2642 | DrugCentral |
| HMDB0240222 | HMDB |
| LSM-15371 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:91-85-0 | DrugCentral |
| Citations |
|---|