EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O3 |
| Net Charge | 0 |
| Average Mass | 194.190 |
| Monoisotopic Mass | 194.06914 |
| SMILES | Nc1ccc(C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13) |
| InChIKey | HSMNQINEKMPTIC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-aminohippuric acid (CHEBI:104011) has role Daphnia magna metabolite (CHEBI:83056) |
| p-aminohippuric acid (CHEBI:104011) is a N-acylglycine (CHEBI:16180) |
| p-aminohippuric acid (CHEBI:104011) is conjugate acid of p-aminohippurate (CHEBI:64703) |
| Incoming Relation(s) |
| p-aminohippurate (CHEBI:64703) is conjugate base of p-aminohippuric acid (CHEBI:104011) |
| IUPAC Name |
|---|
| N-(4-aminobenzoyl)glycine |
| Synonyms | Source |
|---|---|
| Aminohippuric acid | KEGG DRUG |
| N-(p-Aminobenzoyl)aminoacetic acid | ChemIDplus |
| N-(p-Aminobenzoyl)glycine | ChemIDplus |
| N-(para-aminobenzoyl)glycine | ChemIDplus |
| para-Aminohippuric acid | ChemIDplus |
| 4-aminohippuric acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| D06890 | KEGG DRUG |
| DB00345 | DrugBank |
| Aminohippuric_Acid | Wikipedia |
| HMDB0001867 | HMDB |
| LSM-5739 | LINCS |
| 165 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1216376 | Beilstein |
| Gmelin:848144 | Gmelin |
| Reaxys:1213676 | Reaxys |
| CAS:61-78-9 | KEGG DRUG |
| CAS:61-78-9 | ChemIDplus |
| Citations |
|---|