EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO5 |
| Net Charge | 0 |
| Average Mass | 179.172 |
| Monoisotopic Mass | 179.07937 |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122h-1b_1-5_2*N]/1/ |
| InChI | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
| InChIKey | MSWZFWKMSRAUBD-QZABAPFNSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-glucosamine (CHEBI:28393) has functional parent β-D-glucose (CHEBI:15903) |
| β-D-glucosamine (CHEBI:28393) has role plant metabolite (CHEBI:76924) |
| β-D-glucosamine (CHEBI:28393) is a 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| β-D-glucosamine (CHEBI:28393) is conjugate base of β-D-glucosamine(1+) (CHEBI:140810) |
| Incoming Relation(s) |
| GlcpN-(1→1)-α-D-Galp (CHEBI:153875) has functional parent β-D-glucosamine (CHEBI:28393) |
| β-D-GlcN-(1→6)-D-GlcN (CHEBI:146542) has functional parent β-D-glucosamine (CHEBI:28393) |
| β-muramic acid (CHEBI:44312) has functional parent β-D-glucosamine (CHEBI:28393) |
| β-D-glucosamine(1+) (CHEBI:140810) is conjugate acid of β-D-glucosamine (CHEBI:28393) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| beta-D-Glucosamine | KEGG COMPOUND |
| D-GLUCOSAMINE | PDBeChem |
| β-D-glucosamine | IUPAC |
| Citations |
|---|