EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24N3O2 |
| Net Charge | +1 |
| Average Mass | 422.508 |
| Monoisotopic Mass | 422.18630 |
| SMILES | O=C(NN=Cc1ccc(OCc2ccccc2)cc1)c1cc[n+](Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N3O2/c31-27(25-15-17-30(18-16-25)20-23-7-3-1-4-8-23)29-28-19-22-11-13-26(14-12-22)32-21-24-9-5-2-6-10-24/h1-19H,20-21H2/p+1 |
| InChIKey | AFDKQPMETSOVMT-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(4-phenylmethoxyphenyl)methylideneamino]-1-(phenylmethyl)-4-pyridin-1-iumcarboxamide (CHEBI:103952) is a aromatic carboxylic acid (CHEBI:33859) |
| N-[(4-phenylmethoxyphenyl)methylideneamino]-1-(phenylmethyl)-4-pyridin-1-iumcarboxamide (CHEBI:103952) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-15305 | LINCS |