EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:103855 - 4-(2-aminopropyl)phenol
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CC(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7,11H,6,10H2,1H3 |
| InChIKey | GIKNHHRFLCDOEU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-aminopropyl)phenol (CHEBI:103855) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| hydroxyamfetamine hydrobromide | DrugCentral |
| hydroxyamphetamide | DrugCentral |
| hydroxyamphetamin | DrugCentral |
| hydroxyamphetamine | DrugCentral |
| hydroxyamphetamine hydrobromide | DrugCentral |
| methyltyramine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1394 | DrugCentral |
| HMDB0060765 | HMDB |
| LSM-15206 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:103-86-6 | DrugCentral |