EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12C(=C)CC[C@]13[C@H](C)CC[C@@H](C(C)C)[C@]23[H] |
| InChI | InChI=1S/C15H24/c1-9(2)12-6-5-11(4)15-8-7-10(3)13(15)14(12)15/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | FSRZGYRCMPZNJF-KHMAMNHCSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-cubebene (CHEBI:10363) has role plant metabolite (CHEBI:76924) |
| β-cubebene (CHEBI:10363) is a carbotricyclic compound (CHEBI:38032) |
| β-cubebene (CHEBI:10363) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (3aS,3bR,4S,7R,7aR)-7-methyl-3-methylidene-4-(propan-2-yl)octahydro-1H-cyclopenta[1,3]cyclopropa[1,2]benzene |
| Synonyms | Source |
|---|---|
| (−)-β-cubebene | MetaCyc |
| (3aS-(3aalpha,3bbata,4beta,7alpha,7aS*))-octahydro-7-methyl-3-methylene-4-(1-methylethyl)-1Hcyclopenta(1,3)cyclopropa(1,2)benzene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| β-cubebene | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:13744-15-5 | KEGG COMPOUND |
| CAS:13744-15-5 | ChemIDplus |
| Citations |
|---|