EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C1CCCC(C)(C)[C@@]12CC=C(C)CC2 |
| InChI | InChI=1S/C15H24/c1-12-7-10-15(11-8-12)13(2)6-5-9-14(15,3)4/h7H,2,5-6,8-11H2,1,3-4H3/t15-/m1/s1 |
| InChIKey | WLNGPDPILFYWKF-OAHLLOKOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-β-chamigrene (CHEBI:10359) is a β-chamigrene (CHEBI:61744) |
| (−)-β-chamigrene (CHEBI:10359) is enantiomer of (+)-β-chamigrene (CHEBI:61746) |
| Incoming Relation(s) |
| (+)-β-chamigrene (CHEBI:61746) is enantiomer of (−)-β-chamigrene (CHEBI:10359) |
| IUPAC Name |
|---|
| (6R)-3,7,7-trimethyl-11-methylidenespiro[5.5]undec-2-ene |
| Synonyms | Source |
|---|---|
| beta-Chamigrene | KEGG COMPOUND |
| (−)-chamigrene | ChEBI |
| (R)-β-chamigrene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2326950 | Reaxys |
| CAS:18431-82-8 | KEGG COMPOUND |
| CAS:18431-82-8 | ChemIDplus |