EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC1=CC=C(C(C)C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | YHQGMYUVUMAZJR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melaleuca alternifolia (ncbitaxon:164405) | leaf (BTO:0000713) | PubMed (16418522) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-terpinene (CHEBI:10334) has role plant metabolite (CHEBI:76924) |
| α-terpinene (CHEBI:10334) has role volatile oil component (CHEBI:27311) |
| α-terpinene (CHEBI:10334) is a cyclohexadiene (CHEBI:37613) |
| α-terpinene (CHEBI:10334) is a monoterpene (CHEBI:35187) |
| Incoming Relation(s) |
| tea tree oil (CHEBI:83629) has part α-terpinene (CHEBI:10334) |
| IUPAC Name |
|---|
| 1-methyl-4-(propan-2-yl)cyclohexa-1,3-diene |
| Synonyms | Source |
|---|---|
| 1-isopropyl-4-methyl-1,3-cyclohexadiene | ChemIDplus |
| 1-Methyl-4-(1-methylethyl)-1,3-cyclohexadiene | ChemIDplus |
| alpha-Terpinene | KEGG COMPOUND |
| p-Mentha-1,3-diene | ChemIDplus |
| Terpilene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| α-terpinene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2014 | BPDB |
| C00003060 | KNApSAcK |
| C09898 | KEGG COMPOUND |
| HMDB0036995 | HMDB |
| LMPR0102090026 | LIPID MAPS |
| Terpinene | Wikipedia |
| WO2010099985 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1853379 | Reaxys |
| CAS:99-86-5 | KEGG COMPOUND |
| CAS:99-86-5 | ChemIDplus |
| Citations |
|---|