EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O5 |
| Net Charge | 0 |
| Average Mass | 402.491 |
| Monoisotopic Mass | 402.21547 |
| SMILES | CC=Cc1ccc2n(c1=O)C[C@H]1[C@H](CO)[C@@H](C(=O)OC)[C@@H]2N1CC1CCOCC1 |
| InChI | InChI=1S/C22H30N2O5/c1-3-4-15-5-6-17-20-19(22(27)28-2)16(13-25)18(12-24(17)21(15)26)23(20)11-14-7-9-29-10-8-14/h3-6,14,16,18-20,25H,7-13H2,1-2H3/t16-,18-,19+,20+/m0/s1 |
| InChIKey | YYKXHGZVSNLVER-IJXRJRJASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-14673 (CHEBI:103329) is a carboxylic acid (CHEBI:33575) |
| LSM-14673 (CHEBI:103329) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| Manual Xrefs | Databases |
|---|---|
| LSM-14673 | LINCS |