EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N4O4 |
| Net Charge | 0 |
| Average Mass | 448.523 |
| Monoisotopic Mass | 448.21106 |
| SMILES | CC=Cc1ccc2n(c1=O)C[C@H]1[C@H](CO)[C@@H](C(=O)NC3CCC3)[C@@H]2N1C(=O)c1ccccn1 |
| InChI | InChI=1S/C25H28N4O4/c1-2-6-15-10-11-19-22-21(23(31)27-16-7-5-8-16)17(14-30)20(13-28(19)24(15)32)29(22)25(33)18-9-3-4-12-26-18/h2-4,6,9-12,16-17,20-22,30H,5,7-8,13-14H2,1H3,(H,27,31)/t17-,20-,21+,22+/m0/s1 |
| InChIKey | RQFILIGFJPUTQD-GUGJDKNPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-14627 (CHEBI:103283) is a aromatic carboxylic acid (CHEBI:33859) |
| LSM-14627 (CHEBI:103283) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-14627 | LINCS |