EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O8 |
| Net Charge | 0 |
| Average Mass | 400.383 |
| Monoisotopic Mass | 400.11582 |
| SMILES | [H][C@]12COC(=O)[C@]1([H])[C@H](c1cc(OC)c(O)c(OC)c1)c1cc3c(c(O)c1C2)OCO3 |
| InChI | InChI=1S/C21H20O8/c1-25-13-4-9(5-14(26-2)19(13)23)16-11-6-15-20(29-8-28-15)18(22)12(11)3-10-7-27-21(24)17(10)16/h4-6,10,16-17,22-23H,3,7-8H2,1-2H3/t10-,16+,17-/m0/s1 |
| InChIKey | JGGWNGRBXJWAOC-HKJPBSJPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-peltatin (CHEBI:10324) has role antineoplastic agent (CHEBI:35610) |
| α-peltatin (CHEBI:10324) has role metabolite (CHEBI:25212) |
| α-peltatin (CHEBI:10324) is a furonaphthodioxole (CHEBI:50307) |
| α-peltatin (CHEBI:10324) is a lignan (CHEBI:25036) |
| α-peltatin (CHEBI:10324) is a organic heterotetracyclic compound (CHEBI:38163) |
| α-peltatin (CHEBI:10324) is a phenols (CHEBI:33853) |
| α-peltatin (CHEBI:10324) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| β-peltatin (CHEBI:74867) has functional parent α-peltatin (CHEBI:10324) |
| IUPAC Name |
|---|
| (5R,5aR,8aR)-10-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
| Synonyms | Source |
|---|---|
| [5R-(5α,5aα,5aβ,8aα)]-5,8,8a,9-tetrahydro-10-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)furo[3',3':6,7]naphtho[2,3-d]-1,3-dioxo-6(5aH)-one | ChEBI |
| 8-hydroxy-2-hydroxymethyl-6,7-methylenedioxy-4-(4'-hydroxy-3',5'-dimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-3-carboxylic acid lactone | ChEBI |
| NCI 1074 | ChemIDplus |
| NSC 24817 | ChemIDplus |
| α-peltatin A | ChemIDplus |
| Citations |
|---|