EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O3 |
| Net Charge | 0 |
| Average Mass | 154.165 |
| Monoisotopic Mass | 154.06299 |
| SMILES | O=C1OC(=O)C2CCCCC12 |
| InChI | InChI=1S/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h5-6H,1-4H2 |
| InChIKey | MUTGBJKUEZFXGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexahydrophthalic anhydride (CHEBI:103210) has role allergen (CHEBI:50904) |
| hexahydrophthalic anhydride (CHEBI:103210) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| hexahydrophthalic anhydride (CHEBI:103210) is a tetrahydrofurandione (CHEBI:47022) |
| IUPAC Name |
|---|
| hexahydro-2-benzofuran-1,3-dione |
| Synonyms | Source |
|---|---|
| 1,2-Cyclohexanedicarboxylic acid anhydride | ChemIDplus |
| 1,2-Cyclohexane dicarboxylic anhydride | NIST Chemistry WebBook |
| 1,2-Cyclohexanedicarboxylic anhydride | ChemIDplus |
| Cyclohexane-1,2-dicarboxylic acid anhydride | ChEBI |
| Cyclohexane-1,2-dicarboxylic anhydride | ChemIDplus |
| hexahydro-1,3-isobenzofurandione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| KR20100115622 | Patent |
| Citations |
|---|