EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N4O4 |
| Net Charge | 0 |
| Average Mass | 534.701 |
| Monoisotopic Mass | 534.32061 |
| SMILES | C[C@H]1CN([C@@H](C)CO)C(=O)c2c(c3ccccc3n2C)-c2ccccc2CO[C@@H]1CN(C)C(=O)CCN(C)C |
| InChI | InChI=1S/C31H42N4O4/c1-21-17-35(22(2)19-36)31(38)30-29(25-13-9-10-14-26(25)34(30)6)24-12-8-7-11-23(24)20-39-27(21)18-33(5)28(37)15-16-32(3)4/h7-14,21-22,27,36H,15-20H2,1-6H3/t21-,22-,27+/m0/s1 |
| InChIKey | UPHSEAQPRHOHRJ-BCQCSXDESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-14509 (CHEBI:103164) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-14509 | LINCS |