EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | C[C@H](N)[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1 |
| InChIKey | GEFQWZLICWMTKF-CDUCUWFYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-alpha-Methylnoradrenaline (CHEBI:10304) is a catecholamine (CHEBI:33567) |
| Synonyms | Source |
|---|---|
| (-)-alpha-(1-Aminoethyl)-3,4-dihydroxybenzyl alcohol | DrugCentral |
| alpha-Methylnoradrenaline | KEGG COMPOUND |
| alpha-Methylnoradrenaline | KEGG COMPOUND |
| levoepinefrina | DrugCentral |
| Levonordefrin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 4482 | DrugCentral |
| C11768 | KEGG COMPOUND |
| D02388 | KEGG DRUG |
| HMDB0015652 | HMDB |
| LSM-6525 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:829-74-3 | KEGG COMPOUND |