EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10302 - alpha-Methyl-m-tyramine
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CC(N)Cc1cccc(O)c1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)5-8-3-2-4-9(11)6-8/h2-4,6-7,11H,5,10H2,1H3 |
| InChIKey | WTDGMHYYGNJEKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alpha-Methyl-m-tyramine (CHEBI:10302) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| alpha-Methyl-m-tyramine | KEGG COMPOUND |
| d-alpha-Methyl-m-tyramine | DrugCentral |
| Gepefrine | KEGG COMPOUND |