EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@]1(O)OC[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha121h-2a_2-6]/1/ |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5-,6+/m0/s1 |
| InChIKey | LKDRXBCSQODPBY-BGPJRJDNSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-sorbopyranose (CHEBI:10295) is a L-sorbopyranose (CHEBI:48649) |
| α-L-sorbopyranose (CHEBI:10295) is enantiomer of α-D-sorbopyranose (CHEBI:48677) |
| Incoming Relation(s) |
| α-D-sorbopyranose (CHEBI:48677) is enantiomer of α-L-sorbopyranose (CHEBI:10295) |
| IUPAC Name |
|---|
| α-L-sorbopyranose |
| Synonym | Source |
|---|---|
| alpha-L-Sorbopyranose | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08356 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1007083 | Gmelin |
| Beilstein:1423190 | Beilstein |
| CAS:470-15-5 | KEGG COMPOUND |