EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O9P2 |
| Net Charge | 0 |
| Average Mass | 278.090 |
| Monoisotopic Mass | 277.99566 |
| SMILES | C[C@@]1(CO)OP(=O)(O)OP(=O)(O)OC[C@H]1O |
| InChI | InChI=1S/C5H12O9P2/c1-5(3-6)4(7)2-12-15(8,9)14-16(10,11)13-5/h4,6-7H,2-3H2,1H3,(H,8,9)(H,10,11)/t4-,5+/m1/s1 |
| InChIKey | SFRQRNJMIIUYDI-UHNVWZDZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate (CHEBI:18425) has role Escherichia coli metabolite (CHEBI:76971) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate (CHEBI:18425) is a tetritol phosphate (CHEBI:26980) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate (CHEBI:18425) is conjugate acid of 2-C-methyl-D-erythritol 2,4-cyclic diphosphate(2−) (CHEBI:58483) |
| Incoming Relation(s) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate(2−) (CHEBI:58483) is conjugate base of 2-C-methyl-D-erythritol 2,4-cyclic diphosphate (CHEBI:18425) |
| IUPAC Name |
|---|
| (6S,7R)-6-(hydroxymethyl)-6-methyl-1,3,5,2,4-trioxadiphosphocane-2,4,7-triol 2,4-dioxide |
| Synonyms | Source |
|---|---|
| 2-C-Methyl-D-erythritol 2,4-cyclodiphosphate | KEGG COMPOUND |
| 3-Methyl-1,2,3,4-tetrahydroxybutane-1,3-cyclic bisphosphate | KEGG COMPOUND |
| MEcPP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-C-Methyl-D-erythritol-2,4-cyclopyrophosphate | Wikipedia |
| C00007295 | KNApSAcK |
| C11453 | KEGG COMPOUND |
| CDI | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:143488-44-2 | KEGG COMPOUND |