EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12C[C@H](C(C)(C)O)CC[C@@]1(C)CCC=C2C |
| InChI | InChI=1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h6,12-13,16H,5,7-10H2,1-4H3/t12-,13+,15-/m1/s1 |
| InChIKey | FCSRUSQUAVXUKK-VNHYZAJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria japonica (ncbitaxon:3369) | leaf (BTO:0000713) | PubMed (23714012) | Found in essential oil from leaves |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-eudesmol (CHEBI:10278) has role volatile oil component (CHEBI:27311) |
| α-eudesmol (CHEBI:10278) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| α-eudesmol (CHEBI:10278) is a octahydronaphthalenes (CHEBI:138397) |
| α-eudesmol (CHEBI:10278) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Names |
|---|
| 2-[(2R,4aR,8aR)-4a,8-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-2-yl]propan-2-ol |
| eudesm-3-en-11-ol |
| Synonyms | Source |
|---|---|
| alpha-Eudesmol | KEGG COMPOUND |
| (2R,4aR,8aR)-1,2,3,4,4a,5,6,8a-octahydro-α,α,4a,8-tetramethyl-2-naphthalenemethanol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| α-eudesmol | UniProt |