EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38N4O3 |
| Net Charge | 0 |
| Average Mass | 526.681 |
| Monoisotopic Mass | 526.29439 |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)c2c(c3ccccc3n2C)-c2ccccc2CO[C@@H]1CN(C)Cc1cccnc1 |
| InChI | InChI=1S/C32H38N4O3/c1-22-17-36(23(2)20-37)32(38)31-30(27-13-7-8-14-28(27)35(31)4)26-12-6-5-11-25(26)21-39-29(22)19-34(3)18-24-10-9-15-33-16-24/h5-16,22-23,29,37H,17-21H2,1-4H3/t22-,23+,29-/m1/s1 |
| InChIKey | RPGWXCDGQSLPTH-RLPNJSHFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-13855 (CHEBI:102506) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-13855 | LINCS |