EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12C(C)=CC[C@]13[C@H](C)CC[C@@H](C(C)C)[C@]23[H] |
| InChI | InChI=1S/C15H24/c1-9(2)12-6-5-11(4)15-8-7-10(3)13(15)14(12)15/h7,9,11-14H,5-6,8H2,1-4H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | XUEHVOLRMXNRKQ-KHMAMNHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona cherimola (ncbitaxon:49314) | leaf (BTO:0000713) | PubMed (16122763) | |
| Cinnamomum (ncbitaxon:13428) | - | PubMed (18569694) | |
| Citrus grandis (ncbitaxon:37334) | - | PubMed (16332132) | Isolated from peel. |
| Citrus x paradisi (ncbitaxon:37656) | - | PubMed (16332132) | Isolated from peel. |
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (21970810) | ||
| saliva (UBERON:0001836) | PubMed (24421258) | ||
| Lepidagathis fasciculata (IPNI:52001-1) | aerial part (BTO:0001658) | PubMed (24079194) | |
| Matricaria chamomilla (ncbitaxon:98504) | - | PubMed (20385420) | |
| Piper lanceifolium (ncbitaxon:538291) | aerial part (BTO:0001658) | PubMed (19835693) | |
| Solanum verbascifolium (IPNI:332155-2) | leaf (BTO:0000713) | Article (Ruijun et al. (2006) Chemical constituents of essential oil from leaves of Solanum verbascifolium(Solanaceae). Journal of Tropical and Subtropical Botany, 14(6), 526-529.) | |
| Thymus pannonicus (IPNI:461498-1) | - | PubMed (21121273) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-cubebene (CHEBI:10224) has role human metabolite (CHEBI:77746) |
| α-cubebene (CHEBI:10224) has role plant metabolite (CHEBI:76924) |
| α-cubebene (CHEBI:10224) has role volatile oil component (CHEBI:27311) |
| α-cubebene (CHEBI:10224) is a carbotricyclic compound (CHEBI:38032) |
| α-cubebene (CHEBI:10224) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (3aS,3bR,4S,7R,7aR)-3,7-dimethyl-4-(propan-2-yl)-3a,3b,4,5,6,7-hexahydro-1H-cyclopenta[1,3]cyclopropa[1,2]benzene |
| Synonyms | Source |
|---|---|
| (1R,5S,6R,7S,10R)-4,10-dimethyl-7-(propan-2-yl)tricyclo[4.4.0.01,5]dec-3-ene | IUPAC |
| (−)-alpha-cubebene | ChemIDplus |
| alpha-cubebene | ChemIDplus |
| (−)-α-cubebene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| α-cubebene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003120 | KNApSAcK |
| C09647 | KEGG COMPOUND |
| CPD-8739 | MetaCyc |
| FDB015294 | FooDB |
| HMDB0036413 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6857364 | Reaxys |
| CAS:17699-14-8 | NIST Chemistry WebBook |
| CAS:17699-14-8 | ChemIDplus |
| Citations |
|---|