EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10216 - cedr-8-ene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]13CC=C(C)[C@H](C3)C2(C)C |
| InChI | InChI=1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12+,13+,15+/m1/s1 |
| InChIKey | IRAQOCYXUMOFCW-OSFYFWSMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (24023812) | |
| Plectranthus barbatus (ncbitaxon:41228) | aerial part (BTO:0001658) | PubMed (20034210) | Species also known as Coleus forskohlii. |
| Chrysanthemum balsamita (IPNI:57558-2) | - | PubMed (19401923) | Found in flowerhead. |
| Tetraclinis articulata (ncbitaxon:13717) | - | DOI (10.1080/10412905.2005.9698842) | |
| Juniperus foetidissima (ncbitaxon:1719643) | - | DOI (10.1080/10412905.2004.9698707) | |
| Ginkgo biloba (ncbitaxon:3311) | leaf (BTO:0000713) | Article (Yonghong, Z., Jingmian, W., Desheng, L. and Yinhua, Z. (1999) Chemical studies on volatile constituents of Ginkgo biloba L. leaves. Natural product research and development, 11(2), 62-66.) | |
| Cunninghamia lanceolata var. konishii (ncbitaxon:66170) | - | PubMed (23074921) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cedr-8-ene (CHEBI:10216) has parent hydride cedrane (CHEBI:36530) |
| cedr-8-ene (CHEBI:10216) has role human urinary metabolite (CHEBI:84087) |
| cedr-8-ene (CHEBI:10216) has role volatile oil component (CHEBI:27311) |
| cedr-8-ene (CHEBI:10216) is a bridged compound (CHEBI:35990) |
| cedr-8-ene (CHEBI:10216) is a carbotricyclic compound (CHEBI:38032) |
| cedr-8-ene (CHEBI:10216) is a polycyclic olefin (CHEBI:35714) |
| cedr-8-ene (CHEBI:10216) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| cedr-8-ene |
| Synonyms | Source |
|---|---|
| alpha-cedrene | KEGG COMPOUND |
| [3R-(3α,3aβ,7β,8aα)]-2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulene | NIST Chemistry WebBook |
| α-cedrene | NIST Chemistry WebBook |
| (−)-α-cedrene | ChEBI |
| (1S,2R,5S,7S)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-ene | IUPAC |
| (3R,3aS,7S,8aS)-3,6,8,8-tetramethyl-2,3,4,7,8,8a-hexahydro-1H-3a,7-methanoazulene | IUPAC |
| UniProt Name | Source |
|---|---|
| (−)-α-cedrene | UniProt |
| Citations |
|---|