EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O11 |
| Net Charge | 0 |
| Average Mass | 566.644 |
| Monoisotopic Mass | 566.27271 |
| SMILES | [H][C@]12C[C@@H](O)[C@@]3(C)[C@](O)(CC[C@]3([H])C3=CC(=O)OC3)[C@]1([H])CC[C@]1(O)C[C@@H](O[C@@H]3O[C@H](C)[C@H](O)[C@@H](O)[C@H]3O)CC[C@@]12C=O |
| InChI | InChI=1S/C29H42O11/c1-14-22(33)23(34)24(35)25(39-14)40-16-3-6-27(13-30)19-10-20(31)26(2)17(15-9-21(32)38-12-15)5-8-29(26,37)18(19)4-7-28(27,36)11-16/h9,13-14,16-20,22-25,31,33-37H,3-8,10-12H2,1-2H3/t14-,16+,17-,18-,19+,20-,22+,23-,24-,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | MFIXZHBJWSBQJA-OZQKXHGLSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alpha-Antiarin (CHEBI:10214) is a cardenolide glycoside (CHEBI:38092) |
| Synonyms | Source |
|---|---|
| alpha-Antiarin | KEGG COMPOUND |
| Antiarigenin 3-O-beta-D-antiaroside | KEGG COMPOUND |