EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O5 |
| Net Charge | 0 |
| Average Mass | 332.356 |
| Monoisotopic Mass | 332.13722 |
| SMILES | COC(=O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(cccc3=O)[C@H]1N2C(=O)C1CC1 |
| InChI | InChI=1S/C17H20N2O5/c1-24-17(23)14-10(8-20)12-7-18-11(3-2-4-13(18)21)15(14)19(12)16(22)9-5-6-9/h2-4,9-10,12,14-15,20H,5-8H2,1H3/t10-,12-,14+,15+/m0/s1 |
| InChIKey | KUBNHDDGXKERLH-OBCWZRDOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-13069 (CHEBI:101706) is a carboxylic acid (CHEBI:33575) |
| LSM-13069 (CHEBI:101706) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| Manual Xrefs | Databases |
|---|---|
| LSM-13069 | LINCS |