EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N4O5 |
| Net Charge | 0 |
| Average Mass | 490.560 |
| Monoisotopic Mass | 490.22162 |
| SMILES | O=C([C@H]1[C@H](CO)[C@H]2Cn3c(ccc(C4=CCCC4)c3=O)[C@@H]1N2C(=O)c1ccncc1)N1CCOCC1 |
| InChI | InChI=1S/C27H30N4O5/c32-16-20-22-15-30-21(6-5-19(26(30)34)17-3-1-2-4-17)24(23(20)27(35)29-11-13-36-14-12-29)31(22)25(33)18-7-9-28-10-8-18/h3,5-10,20,22-24,32H,1-2,4,11-16H2/t20-,22-,23+,24+/m1/s1 |
| InChIKey | COTUBAWVYSPTNF-AZOUXBGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-12915 (CHEBI:101552) is a aromatic carboxylic acid (CHEBI:33859) |
| LSM-12915 (CHEBI:101552) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-12915 | LINCS |