EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30N2O5 |
| Net Charge | 0 |
| Average Mass | 342.436 |
| Monoisotopic Mass | 342.21547 |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C17H30N2O5/c1-6-23-17(22)14-13(24-14)16(21)19-12(9-11(4)5)15(20)18-8-7-10(2)3/h10-14H,6-9H2,1-5H3,(H,18,20)(H,19,21)/t12-,13-,14-/m0/s1 |
| InChIKey | SRVFFFJZQVENJC-IHRRRGAJSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aloxistatin (CHEBI:101381) has role anticoronaviral agent (CHEBI:149553) |
| aloxistatin (CHEBI:101381) has role cathepsin B inhibitor (CHEBI:64932) |
| aloxistatin (CHEBI:101381) is a L-leucine derivative (CHEBI:25018) |
| aloxistatin (CHEBI:101381) is a epoxide (CHEBI:32955) |
| aloxistatin (CHEBI:101381) is a ethyl ester (CHEBI:23990) |
| aloxistatin (CHEBI:101381) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| ethyl (2S,3S)-3-({(2S)-4-methyl-1-[(3-methylbutyl)amino]-1-oxopentan-2-yl}carbamoyl)oxirane-2-carboxylate |
| INNs | Source |
|---|---|
| aloxistatin | ChemIDplus |
| aloxistatina | ChemIDplus |
| aloxistatine | ChemIDplus |
| aloxistatinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| E 64d | ChEBI |
| E-64d | ChEBI |
| E64d | ChEBI |
| Ethyl (+)-(2S,3S)-2,3-epoxy-N-((S)-1-(isopentylcarbamoyl)-3-methylbutyl)succinamate | ChemIDplus |
| Loxistatin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5354546 | Reaxys |
| CAS:88321-09-9 | ChemIDplus |
| Citations |
|---|