EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O4 |
| Net Charge | 0 |
| Average Mass | 294.391 |
| Monoisotopic Mass | 294.18311 |
| SMILES | CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H26O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h8,10-11,14,18,20H,3-7,9,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | NLDDIKRKFXEWBK-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gingerol (CHEBI:10136) has role antineoplastic agent (CHEBI:35610) |
| gingerol (CHEBI:10136) has role plant metabolite (CHEBI:76924) |
| gingerol (CHEBI:10136) is a guaiacols (CHEBI:134251) |
| gingerol (CHEBI:10136) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (5S)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)decan-3-one |
| Synonyms | Source |
|---|---|
| [6]-Gingerol | KEGG COMPOUND |
| 6-Gingerol | HMDB |
| (+)-5-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-decanone | ChemIDplus |
| (S)-(6)-Gingerol | ChemIDplus |
| (S)-(+)-[6]Gingerol | KEGG COMPOUND |
| 6-Gingerol | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5287467 | Reaxys |
| CAS:23513-14-6 | KEGG COMPOUND |
| CAS:23513-14-6 | ChemIDplus |
| Citations |
|---|