EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O2S2 |
| Net Charge | 0 |
| Average Mass | 350.464 |
| Monoisotopic Mass | 350.04352 |
| SMILES | Oc1ccc2ccccc2c1SSc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H14O2S2/c21-17-11-9-13-5-1-3-7-15(13)19(17)23-24-20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,21-22H |
| InChIKey | RFAXLXKIAKIUDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IPA-3 (CHEBI:101355) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| IPA-3 (CHEBI:101355) is a naphthols (CHEBI:25392) |
| IPA-3 (CHEBI:101355) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| 1,1'-disulfanediyldi(naphthalen-2-ol) |
| Synonyms | Source |
|---|---|
| 1,1'-Dithiodi-2-naphthol | ChemIDplus |
| Bis(2-hydroxy-1-naphthyl) disulfide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-6312 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2598991 | Reaxys |
| CAS:42521-82-4 | ChemIDplus |
| Citations |
|---|