EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29N4O3 |
| Net Charge | +1 |
| Average Mass | 457.554 |
| Monoisotopic Mass | 457.22342 |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc([NH2+]Cc2cncn2)cc1-c1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H28N4O3/c1-17(2)12-25(27(33)34)31-26(32)23-11-10-19(29-15-20-14-28-16-30-20)13-24(23)22-9-5-7-18-6-3-4-8-21(18)22/h3-11,13-14,16-17,25,29H,12,15H2,1-2H3,(H,28,30)(H,31,32)(H,33,34)/p+1/t25-/m0/s1 |
| InChIKey | ODTFPKNIFYMEHP-VWLOTQADSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GGTI-2133 free base(1+) (CHEBI:101333) is a ammonium ion derivative (CHEBI:35274) |
| GGTI-2133 free base(1+) (CHEBI:101333) is a organic cation (CHEBI:25697) |
| GGTI-2133 free base(1+) (CHEBI:101333) is conjugate acid of GGTI-2133 free base (CHEBI:101257) |
| Incoming Relation(s) |
| GGTI-2133 (CHEBI:101279) has part GGTI-2133 free base(1+) (CHEBI:101333) |
| GGTI-2133 free base (CHEBI:101257) is conjugate base of GGTI-2133 free base(1+) (CHEBI:101333) |
| IUPAC Name |
|---|
| 4-{[(1S)-1-carboxy-3-methylbutyl]carbamoyl}-N-[(1H-imidazol-4-yl)methyl]-3-(naphthalen-1-yl)anilinium |
| Synonym | Source |
|---|---|
| GGTI-2133 free base cation | ChEBI |