EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O |
| Net Charge | 0 |
| Average Mass | 307.397 |
| Monoisotopic Mass | 307.16846 |
| SMILES | Cc1ccc(-c2nc3ccc(C)cn3c2CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-13-5-8-15(9-6-13)19-16(11-18(23)21(3)4)22-12-14(2)7-10-17(22)20-19/h5-10,12H,11H2,1-4H3 |
| InChIKey | ZAFYATHCZYHLPB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. |
| Applications: | GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zolpidem (CHEBI:10125) has role central nervous system depressant (CHEBI:35488) |
| zolpidem (CHEBI:10125) has role GABA agonist (CHEBI:51373) |
| zolpidem (CHEBI:10125) has role sedative (CHEBI:35717) |
| zolpidem (CHEBI:10125) is a imidazopyridine (CHEBI:46908) |
| Incoming Relation(s) |
| zolpidem tartrate (CHEBI:10126) has part zolpidem (CHEBI:10125) |
| IUPAC Name |
|---|
| N,N-dimethyl-2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide |
| INNs | Source |
|---|---|
| zolpidem | KEGG DRUG |
| zolpidemum | DrugBank |
| Synonym | Source |
|---|---|
| N,N,6-Trimethyl-2-(4-methylphenyl)imidazo(1,2-a)pyridine-3-acetamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4355785 | Beilstein |
| CAS:82626-48-0 | KEGG COMPOUND |
| CAS:82626-48-0 | KEGG DRUG |
| CAS:82626-48-0 | DrugBank |
| CAS:82626-48-0 | ChemIDplus |
| CAS:82626-48-0 | NIST Chemistry WebBook |