EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10119 - ziprasidone
| Formula | C21H21ClN4OS |
| Net Charge | 0 |
| Average Mass | 412.946 |
| Monoisotopic Mass | 412.11246 |
| SMILES | O=C1Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C21H21ClN4OS/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21/h1-4,11,13H,5-10,12H2,(H,23,27) |
| InChIKey | MVWVFYHBGMAFLY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ziprasidone (CHEBI:10119) has role antipsychotic agent (CHEBI:35476) |
| ziprasidone (CHEBI:10119) has role dopaminergic antagonist (CHEBI:48561) |
| ziprasidone (CHEBI:10119) has role histamine antagonist (CHEBI:37956) |
| ziprasidone (CHEBI:10119) has role muscarinic antagonist (CHEBI:48876) |
| ziprasidone (CHEBI:10119) has role psychotropic drug (CHEBI:35471) |
| ziprasidone (CHEBI:10119) has role serotonergic antagonist (CHEBI:48279) |
| ziprasidone (CHEBI:10119) is a 1,2-benzisothiazole (CHEBI:55505) |
| ziprasidone (CHEBI:10119) is a indolones (CHEBI:24829) |
| ziprasidone (CHEBI:10119) is a organochlorine compound (CHEBI:36683) |
| ziprasidone (CHEBI:10119) is a piperazines (CHEBI:26144) |
| Incoming Relation(s) |
| ziprasidone hydrochloride hydrate (CHEBI:32314) has part ziprasidone (CHEBI:10119) |
| ziprasidone mesylate trihydrate (CHEBI:53757) has part ziprasidone (CHEBI:10119) |
| IUPAC Name |
|---|
| 5-{2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl}-6-chloro-1,3-dihydro-2H-indol-2-one |
| INNs | Source |
|---|---|
| ziprasidone | ChEBI |
| ziprasidona | ChEBI |
| ziprasidonum | ChEBI |
| ziprasidone | KEGG DRUG |
| Synonym | Source |
|---|---|
| Ziprasidone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6669199 | Beilstein |
| CAS:146939-27-7 | ChemIDplus |
| CAS:146939-27-7 | KEGG DRUG |
| CAS:146939-27-7 | DrugBank |