EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10119 - ziprasidone
| Formula | C21H21ClN4OS |
| Net Charge | 0 |
| Average Mass | 412.946 |
| Monoisotopic Mass | 412.11246 |
| SMILES | O=C1Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C21H21ClN4OS/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21/h1-4,11,13H,5-10,12H2,(H,23,27) |
| InChIKey | MVWVFYHBGMAFLY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ziprasidone (CHEBI:10119) has role antidepressant (CHEBI:35469) |
| ziprasidone (CHEBI:10119) has role antipsychotic agent (CHEBI:35476) |
| ziprasidone (CHEBI:10119) has role anxiolytic drug (CHEBI:35474) |
| ziprasidone (CHEBI:10119) has role cardiovascular drug (CHEBI:35554) |
| ziprasidone (CHEBI:10119) has role dopaminergic antagonist (CHEBI:48561) |
| ziprasidone (CHEBI:10119) has role histamine antagonist (CHEBI:37956) |
| ziprasidone (CHEBI:10119) has role muscarinic antagonist (CHEBI:48876) |
| ziprasidone (CHEBI:10119) has role psychotropic drug (CHEBI:35471) |
| ziprasidone (CHEBI:10119) has role serotonergic antagonist (CHEBI:48279) |
| ziprasidone (CHEBI:10119) is a 1,2-benzisothiazole (CHEBI:55505) |
| ziprasidone (CHEBI:10119) is a indolones (CHEBI:24829) |
| ziprasidone (CHEBI:10119) is a organochlorine compound (CHEBI:36683) |
| ziprasidone (CHEBI:10119) is a piperazines (CHEBI:26144) |
| Incoming Relation(s) |
| ziprasidone hydrochloride hydrate (CHEBI:32314) has part ziprasidone (CHEBI:10119) |
| ziprasidone mesylate trihydrate (CHEBI:53757) has part ziprasidone (CHEBI:10119) |
| IUPAC Name |
|---|
| 5-{2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl}-6-chloro-1,3-dihydro-2H-indol-2-one |
| INNs | Source |
|---|---|
| ziprasidona | ChEBI |
| ziprasidone | KEGG DRUG |
| ziprasidone | ChEBI |
| ziprasidonum | ChEBI |
| Synonyms | Source |
|---|---|
| CP-88059 | ChEMBL |
| Zipradon | ChEMBL |
| Ziprasidone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6669199 | Beilstein |
| CAS:146939-27-7 | KEGG DRUG |
| CAS:146939-27-7 | ChemIDplus |
| CAS:146939-27-7 | DrugBank |
| Citations |
|---|