EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]1([C@@H](C)CCC=C(C)C)C=CC(C)=CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-10,14-15H,5,7,11H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | KKOXKGNSUHTUBV-LSDHHAIUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zingiberene (CHEBI:10115) is a cyclohexadiene (CHEBI:37613) |
| zingiberene (CHEBI:10115) is a sesquiterpene (CHEBI:35189) |
| zingiberene (CHEBI:10115) is enantiomer of ent-zingiberene (CHEBI:583099) |
| Incoming Relation(s) |
| ent-zingiberene (CHEBI:583099) is enantiomer of zingiberene (CHEBI:10115) |
| IUPAC Name |
|---|
| (5R)-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-1,3-diene |
| Synonyms | Source |
|---|---|
| (5R)-5-[(1S)-1,5-dimethyl-4-hexenyl]-2-methyl-1,3-cyclohexadiene | ChEBI |
| (−)-zingiberene | ChEBI |
| α-zingiberene | ChEBI |
| (−)-α-zingiberene | ChEBI |
| alpha-Zingiberene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| α-zingiberene | UniProt |