EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2S |
| Net Charge | 0 |
| Average Mass | 236.296 |
| Monoisotopic Mass | 236.06195 |
| SMILES | CC(c1cc2ccccc2s1)N(O)C(N)=O |
| InChI | InChI=1S/C11H12N2O2S/c1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10/h2-7,15H,1H3,(H2,12,14) |
| InChIKey | MWLSOWXNZPKENC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. antifibrotic agent Any agent which acts to reduce fibrosis. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-asthmatic agent Any compound that has anti-asthmatic effects. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. anti-asthmatic drug A drug used to treat asthma. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zileuton (CHEBI:10112) has parent hydride 1-benzothiophene (CHEBI:35858) |
| zileuton (CHEBI:10112) has role anti-anaemic agent (CHEBI:75835) |
| zileuton (CHEBI:10112) has role anti-asthmatic agent (CHEBI:65023) |
| zileuton (CHEBI:10112) has role anti-asthmatic drug (CHEBI:49167) |
| zileuton (CHEBI:10112) has role anti-inflammatory agent (CHEBI:67079) |
| zileuton (CHEBI:10112) has role antifibrotic agent (CHEBI:233423) |
| zileuton (CHEBI:10112) has role antineoplastic agent (CHEBI:35610) |
| zileuton (CHEBI:10112) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| zileuton (CHEBI:10112) has role ferroptosis inhibitor (CHEBI:173084) |
| zileuton (CHEBI:10112) has role leukotriene antagonist (CHEBI:49159) |
| zileuton (CHEBI:10112) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| zileuton (CHEBI:10112) is a 1-benzothiophenes (CHEBI:38836) |
| zileuton (CHEBI:10112) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-[1-(1-benzothien-2-yl)ethyl]-1-hydroxyurea |
| INNs | Source |
|---|---|
| zileuton | ChemIDplus |
| zileuton | WHO MedNet |
| zileutón | WHO MedNet |
| zileutonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-1-(1-Benzo[b]thien-2-ylethyl)-1-hydroxyurea | ChEBI |
| ABBOTT-64077 | ChEMBL |
| N-[1-(benzo[b]thiophen-2-yl)ethyl]-N-hydroxyurea | ChEBI |
| Leutrol | ChemIDplus |
| N-(1-Benzo(b)thien-2-ylethyl)-N-hydroxyurea | ChemIDplus |
| NSC-730712 | ChEMBL |
| Brand Names | Source |
|---|---|
| Zyflo | KEGG DRUG |
| Zyflo cr | ChEMBL |
| Citations |
|---|