EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2S |
| Net Charge | 0 |
| Average Mass | 236.296 |
| Monoisotopic Mass | 236.06195 |
| SMILES | CC(c1cc2ccccc2s1)N(O)C(N)=O |
| InChI | InChI=1S/C11H12N2O2S/c1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10/h2-7,15H,1H3,(H2,12,14) |
| InChIKey | MWLSOWXNZPKENC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zileuton (CHEBI:10112) has parent hydride 1-benzothiophene (CHEBI:35858) |
| zileuton (CHEBI:10112) has role anti-asthmatic drug (CHEBI:49167) |
| zileuton (CHEBI:10112) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| zileuton (CHEBI:10112) has role ferroptosis inhibitor (CHEBI:173084) |
| zileuton (CHEBI:10112) has role leukotriene antagonist (CHEBI:49159) |
| zileuton (CHEBI:10112) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| zileuton (CHEBI:10112) is a 1-benzothiophenes (CHEBI:38836) |
| zileuton (CHEBI:10112) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-[1-(1-benzothien-2-yl)ethyl]-1-hydroxyurea |
| INNs | Source |
|---|---|
| zileuton | WHO MedNet |
| zileuton | ChemIDplus |
| zileutón | WHO MedNet |
| zileutonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-1-(1-Benzo[b]thien-2-ylethyl)-1-hydroxyurea | ChEBI |
| N-[1-(benzo[b]thiophen-2-yl)ethyl]-N-hydroxyurea | ChEBI |
| Leutrol | ChemIDplus |
| N-(1-Benzo(b)thien-2-ylethyl)-N-hydroxyurea | ChemIDplus |
| Zileuton | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Zyflo | KEGG DRUG |
| Citations |
|---|