EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO7 |
| Net Charge | 0 |
| Average Mass | 311.290 |
| Monoisotopic Mass | 311.10050 |
| SMILES | N#C[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H17NO7/c15-5-9(7-2-1-3-8(17)4-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-4,9-14,16-20H,6H2/t9-,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | KCVXNPDAHDGXFD-YOVYLDAJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Zierin (CHEBI:10111) is a cyanogenic glycoside (CHEBI:23436) |
| Synonyms | Source |
|---|---|
| Benzeneacetonitrile, alpha-(beta-D-glucopyranosyloxy)-3-hydroxy-, (S) | KEGG COMPOUND |
| Zierin | KEGG COMPOUND |