EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-24,35-36,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36-/m1/s1 |
| InChIKey | JKQXZKUSFCKOGQ-QAYBQHTQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hormoscilla (ncbitaxon:881023) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeaxanthin (CHEBI:27547) has parent hydride β-carotene (CHEBI:17579) |
| zeaxanthin (CHEBI:27547) has role antioxidant (CHEBI:22586) |
| zeaxanthin (CHEBI:27547) has role bacterial metabolite (CHEBI:76969) |
| zeaxanthin (CHEBI:27547) has role cofactor (CHEBI:23357) |
| zeaxanthin (CHEBI:27547) is a carotenol (CHEBI:23045) |
| Incoming Relation(s) |
| thermozeaxanthin-17 (CHEBI:80207) has functional parent zeaxanthin (CHEBI:27547) |
| zeaxanthin bis(β-D-glucoside) (CHEBI:63067) has functional parent zeaxanthin (CHEBI:27547) |
| IUPAC Name |
|---|
| (3R,3'R)-β,β-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| (3R,3'R)-dihydroxy-β,β-carotene | ChEBI |
| anchovyxanthin | ChEBI |
| all-trans-β-carotene-3,3'-diol | ChEBI |
| Zeaxanthin | KEGG COMPOUND |
| β,β-carotene-3,3'-diol | ChEBI |
| UniProt Name | Source |
|---|---|
| all-trans-zeaxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000931 | KNApSAcK |
| C06098 | KEGG COMPOUND |
| CPD1F-130 | MetaCyc |
| LMPR01070261 | LIPID MAPS |
| Zeaxanthin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2068416 | Beilstein |
| CAS:144-68-3 | ChemIDplus |
| CAS:144-68-3 | KEGG COMPOUND |