EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10103 - zaluzanin C
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | [H][C@@]12C[C@H](O)C(=C)[C@]1([H])[C@H]1OC(=O)C(=C)[C@@H]1CCC2=C |
| InChI | InChI=1S/C15H18O3/c1-7-4-5-10-8(2)15(17)18-14(10)13-9(3)12(16)6-11(7)13/h10-14,16H,1-6H2/t10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | XFVLNEYIZGZDHP-PEDHHIEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaluzanin C (CHEBI:10103) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| zaluzanin C (CHEBI:10103) has role metabolite (CHEBI:25212) |
| zaluzanin C (CHEBI:10103) is a guaiane sesquiterpenoid (CHEBI:36744) |
| zaluzanin C (CHEBI:10103) is a organic heterotricyclic compound (CHEBI:26979) |
| zaluzanin C (CHEBI:10103) is a secondary alcohol (CHEBI:35681) |
| zaluzanin C (CHEBI:10103) is a sesquiterpene lactone (CHEBI:37667) |
| zaluzanin C (CHEBI:10103) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,6aR,8S,9aR,9bS)-8-hydroxy-3,6,9-trimethylidenedecahydroazuleno[4,5-b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| 3β-hydroxy-4(15),10(14),11(13)-guaiatrien-12,6-olide | ChEBI |
| Zaluzanin C | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4696078 | Reaxys |
| CAS:16838-87-2 | KEGG COMPOUND |
| CAS:16838-87-2 | ChemIDplus |
| Citations |
|---|