EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N5O |
| Net Charge | 0 |
| Average Mass | 305.341 |
| Monoisotopic Mass | 305.12766 |
| SMILES | CCN(C(C)=O)c1cccc(-c2ccnc3c(C#N)cnn23)c1 |
| InChI | InChI=1S/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
| InChIKey | HUNXMJYCHXQEGX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaleplon (CHEBI:10102) has role anticonvulsant (CHEBI:35623) |
| zaleplon (CHEBI:10102) has role anxiolytic drug (CHEBI:35474) |
| zaleplon (CHEBI:10102) has role central nervous system depressant (CHEBI:35488) |
| zaleplon (CHEBI:10102) has role sedative (CHEBI:35717) |
| zaleplon (CHEBI:10102) is a nitrile (CHEBI:18379) |
| zaleplon (CHEBI:10102) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-ethylacetamide |
| INN | Source |
|---|---|
| zaleplon | KEGG DRUG |
| Synonym | Source |
|---|---|
| 3'-(3-Cyanopyrazolo(1,5-a)pyrimidin-7-yl)-N-ethylacetanilide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8153844 | Beilstein |
| CAS:151319-34-5 | ChemIDplus |
| CAS:151319-34-5 | KEGG COMPOUND |
| CAS:151319-34-5 | NIST Chemistry WebBook |
| CAS:151319-34-5 | DrugBank |
| CAS:151319-34-5 | KEGG DRUG |