EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10102 - zaleplon
| Formula | C17H15N5O |
| Net Charge | 0 |
| Average Mass | 305.341 |
| Monoisotopic Mass | 305.12766 |
| SMILES | CCN(C(C)=O)c1cccc(-c2ccnc3c(C#N)cnn23)c1 |
| InChI | InChI=1S/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
| InChIKey | HUNXMJYCHXQEGX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. anticonvulsant A drug used to prevent seizures or reduce their severity. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaleplon (CHEBI:10102) has role anticonvulsant (CHEBI:35623) |
| zaleplon (CHEBI:10102) has role anxiolytic drug (CHEBI:35474) |
| zaleplon (CHEBI:10102) has role central nervous system depressant (CHEBI:35488) |
| zaleplon (CHEBI:10102) has role sedative (CHEBI:35717) |
| zaleplon (CHEBI:10102) is a nitrile (CHEBI:18379) |
| zaleplon (CHEBI:10102) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-ethylacetamide |
| INN | Source |
|---|---|
| zaleplon | KEGG DRUG |
| Synonym | Source |
|---|---|
| 3'-(3-Cyanopyrazolo(1,5-a)pyrimidin-7-yl)-N-ethylacetanilide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8153844 | Beilstein |
| CAS:151319-34-5 | KEGG COMPOUND |
| CAS:151319-34-5 | KEGG DRUG |
| CAS:151319-34-5 | DrugBank |
| CAS:151319-34-5 | ChemIDplus |
| CAS:151319-34-5 | NIST Chemistry WebBook |