EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N5O |
| Net Charge | 0 |
| Average Mass | 305.341 |
| Monoisotopic Mass | 305.12766 |
| SMILES | CCN(C(C)=O)c1cccc(-c2ccnc3c(C#N)cnn23)c1 |
| InChI | InChI=1S/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
| InChIKey | HUNXMJYCHXQEGX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anticonvulsant A drug used to prevent seizures or reduce their severity. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaleplon (CHEBI:10102) has role anticonvulsant (CHEBI:35623) |
| zaleplon (CHEBI:10102) has role antidepressant (CHEBI:35469) |
| zaleplon (CHEBI:10102) has role antipsychotic agent (CHEBI:35476) |
| zaleplon (CHEBI:10102) has role anxiolytic drug (CHEBI:35474) |
| zaleplon (CHEBI:10102) has role central nervous system depressant (CHEBI:35488) |
| zaleplon (CHEBI:10102) has role sedative (CHEBI:35717) |
| zaleplon (CHEBI:10102) is a nitrile (CHEBI:18379) |
| zaleplon (CHEBI:10102) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-ethylacetamide |
| INNs | Source |
|---|---|
| zaleplon | KEGG DRUG |
| zaleplone | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3'-(3-Cyanopyrazolo(1,5-a)pyrimidin-7-yl)-N-ethylacetanilide | ChemIDplus |
| L-846 | ChEMBL |
| L846 | ChEMBL |
| LJC 10846 | ChEMBL |
| LJC-10846 | ChEMBL |
| LJC10846 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8153844 | Beilstein |
| CAS:151319-34-5 | KEGG DRUG |
| CAS:151319-34-5 | KEGG COMPOUND |
| CAS:151319-34-5 | NIST Chemistry WebBook |
| CAS:151319-34-5 | ChemIDplus |
| CAS:151319-34-5 | DrugBank |
| Citations |
|---|