EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O3 |
| Net Charge | 0 |
| Average Mass | 211.221 |
| Monoisotopic Mass | 211.09569 |
| SMILES | Nc1ccn([C@H]2CC[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O3/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m0/s1 |
| InChIKey | WREGKURFCTUGRC-POYBYMJQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zalcitabine (CHEBI:10101) has role antimetabolite (CHEBI:35221) |
| zalcitabine (CHEBI:10101) has role antiviral drug (CHEBI:36044) |
| zalcitabine (CHEBI:10101) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| zalcitabine (CHEBI:10101) is a pyrimidine 2',3'-dideoxyribonucleoside (CHEBI:48441) |
| IUPAC Name |
|---|
| 2',3'-dideoxycytidine |
| INN | Source |
|---|---|
| zalcitabine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 2',3'-Dideoxycytidine | KEGG COMPOUND |
| DDC | DrugBank |
| DDCYD | DrugBank |
| Dideoxycytidine | DrugBank |
| 4-amino-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2(1H)-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C07207 | KEGG COMPOUND |
| D00412 | KEGG DRUG |
| DB00943 | DrugBank |
| Zalcitabine | Wikipedia |
| HMDB0015078 | HMDB |
| LSM-5915 | LINCS |
| 2856 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:654956 | Reaxys |
| CAS:7481-89-2 | KEGG COMPOUND |
| CAS:7481-89-2 | KEGG DRUG |
| CAS:7481-89-2 | DrugBank |
| CAS:7481-89-2 | ChemIDplus |
| Citations |
|---|