EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H33N3O6S |
| Net Charge | 0 |
| Average Mass | 575.687 |
| Monoisotopic Mass | 575.20901 |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cc1cn(C)c2ccc(NC(=O)OC3CCCC3)cc12 |
| InChI | InChI=1S/C31H33N3O6S/c1-20-8-4-7-11-29(20)41(37,38)33-30(35)22-13-12-21(28(17-22)39-3)16-23-19-34(2)27-15-14-24(18-26(23)27)32-31(36)40-25-9-5-6-10-25/h4,7-8,11-15,17-19,25H,5-6,9-10,16H2,1-3H3,(H,32,36)(H,33,35) |
| InChIKey | YEEZWCHGZNKEEK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zafirlukast (CHEBI:10100) has role anti-asthmatic agent (CHEBI:65023) |
| zafirlukast (CHEBI:10100) has role leukotriene antagonist (CHEBI:49159) |
| zafirlukast (CHEBI:10100) is a N-sulfonylcarboxamide (CHEBI:90852) |
| zafirlukast (CHEBI:10100) is a carbamate ester (CHEBI:23003) |
| zafirlukast (CHEBI:10100) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| cyclopentyl 3-[2-methoxy-4-(2-methylphenylsulfonylcarbamoyl)benzyl]-1-methyl-1H-indol-5-ylcarbamate |
| INN | Source |
|---|---|
| zafirlukast | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(5-cyclopentyloxycarbonylamino-1-methyl-1H-indol-3-ylmethyl)-3-methoxy-N-o-tolylsulfonylbenzamide | ChEBI |
| cyclopentyl 3-(2-methoxy-4-((o-tolylsulfonyl)carbamoyl)benzyl)-1-methylindole-5-carbamate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Accolate | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2855 | DrugCentral |
| C07206 | KEGG COMPOUND |
| D00411 | KEGG DRUG |
| DB00549 | DrugBank |
| HMDB0014689 | HMDB |
| LSM-5792 | LINCS |
| Zafirlukast | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3641829 | Reaxys |
| CAS:107753-78-6 | KEGG COMPOUND |
| CAS:107753-78-6 | ChemIDplus |
| Citations |
|---|